C16H25NO — CID 143328584
(2E)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-N-methylocta-2,7-dien-3-amine (PubChem CID 143328584) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (2E)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-N-methylocta-2,7-dien-3-amine.
| Compound Name | (2E)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-N-methylocta-2,7-dien-3-amine |
|---|---|
| PubChem CID | 143328584 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (2E)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-N-methylocta-2,7-dien-3-amine |
| SMILES | C=C/C(=C\C=C/C)OC(C=C)CC/C(=C\C)NC |
| InChI | InChI=1S/C16H25NO/c1-6-10-11-15(8-3)18-16(9-4)13-12-14(7-2)17-5/h6-11,16-17H,3-4,12-13H2,1-2,5H3/b10-6-,14-7+,15-11+ |
| InChIKey | HAODBCYRRXJDPP-UMXYUYLFSA-N |
| XLogP | 4.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|