C21H32O4 — CID 134288144
2-[[(1E,3Z)-5-[4,4-dimethyl-1-(oxiran-2-yl)hexan-2-yl]oxy-1-ethenylhexa-1,3,5-trienoxy]methyl]oxirane (PubChem CID 134288144) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is 2-[[(1E,3Z)-5-[4,4-dimethyl-1-(oxiran-2-yl)hexan-2-yl]oxy-1-ethenylhexa-1,3,5-trienoxy]methyl]oxirane.
| Compound Name | 2-[[(1E,3Z)-5-[4,4-dimethyl-1-(oxiran-2-yl)hexan-2-yl]oxy-1-ethenylhexa-1,3,5-trienoxy]methyl]oxirane |
|---|---|
| PubChem CID | 134288144 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 2-[[(1E,3Z)-5-[4,4-dimethyl-1-(oxiran-2-yl)hexan-2-yl]oxy-1-ethenylhexa-1,3,5-trienoxy]methyl]oxirane |
| SMILES | C=C/C(=C\C=C/C(=C)OC(CC1CO1)CC(C)(C)CC)OCC1CO1 |
| InChI | InChI=1S/C21H32O4/c1-6-17(22-14-20-15-24-20)10-8-9-16(3)25-18(11-19-13-23-19)12-21(4,5)7-2/h6,8-10,18-20H,1,3,7,11-15H2,2,4-5H3/b9-8-,17-10+ |
| InChIKey | CFEIYEDEGUKVNU-ABHVWSBLSA-N |
| XLogP | 4.54 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|