C25H41N5 — CID 66903427
4-(azepan-1-yl)-N-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidin-4-yl]pyrimidin-2-amine (PubChem CID 66903427) has the molecular formula C25H41N5 and a molecular weight of 411.64 g/mol. Its IUPAC name is 4-(azepan-1-yl)-N-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidin-4-yl]pyrimidin-2-amine.
| Compound Name | 4-(azepan-1-yl)-N-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidin-4-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 66903427 |
| Molecular Formula | C25H41N5 |
| Molecular Weight | 411.64 g/mol |
| Exact Mass | 411.34 |
| IUPAC Name | 4-(azepan-1-yl)-N-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]piperidin-4-yl]pyrimidin-2-amine |
| SMILES | CC(C)=CCC/C(C)=C/CN1CCC(Nc2nccc(N3CCCCCC3)n2)CC1 |
| InChI | InChI=1S/C25H41N5/c1-21(2)9-8-10-22(3)12-18-29-19-13-23(14-20-29)27-25-26-15-11-24(28-25)30-16-6-4-5-7-17-30/h9,11-12,15,23H,4-8,10,13-14,16-20H2,1-3H3,(H,26,27,28)/b22-12+ |
| InChIKey | BLBYMGIKZCCXPM-WSDLNYQXSA-N |
| XLogP | 5.43 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.64 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|