About 3-phenyl-5-[4-(3-phenylprop-2-ynyl)piperazin-1-yl]-1,2,4-thiadiazole
3-phenyl-5-[4-(3-phenylprop-2-ynyl)piperazin-1-yl]-1,2,4-thiadiazole (PubChem CID 68528255) has the molecular formula C21H20N4S
and a molecular weight of 360.49 g/mol. Its IUPAC name is 3-phenyl-5-[4-(3-phenylprop-2-ynyl)piperazin-1-yl]-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 3-phenyl-5-[4-(3-phenylprop-2-ynyl)piperazin-1-yl]-1,2,4-thiadiazole |
| PubChem CID | 68528255 |
| Molecular Formula | C21H20N4S |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 3-phenyl-5-[4-(3-phenylprop-2-ynyl)piperazin-1-yl]-1,2,4-thiadiazole |
| SMILES | C(#Cc1ccccc1)CN1CCN(c2nc(-c3ccccc3)ns2)CC1 |
| InChI | InChI=1S/C21H20N4S/c1-3-8-18(9-4-1)10-7-13-24-14-16-25(17-15-24)21-22-20(23-26-21)19-11-5-2-6-12-19/h1-6,8-9,11-12H,13-17H2 |
| InChIKey | RRPYMXXQOVNQKN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-5-[4-(3-phenylprop-2-ynyl)piperazin-1-yl]-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-5-[4-(3-phenylprop-2-ynyl)piperazin-1-yl]-1,2,4-thiadiazole?
The IUPAC name of 3-phenyl-5-[4-(3-phenylprop-2-ynyl)piperazin-1-yl]-1,2,4-thiadiazole (CID 68528255) is 3-phenyl-5-[4-(3-phenylprop-2-ynyl)piperazin-1-yl]-1,2,4-thiadiazole.
What is the SMILES notation for 3-phenyl-5-[4-(3-phenylprop-2-ynyl)piperazin-1-yl]-1,2,4-thiadiazole?
The canonical SMILES for 3-phenyl-5-[4-(3-phenylprop-2-ynyl)piperazin-1-yl]-1,2,4-thiadiazole is C(#Cc1ccccc1)CN1CCN(c2nc(-c3ccccc3)ns2)CC1.
What is the InChIKey of 3-phenyl-5-[4-(3-phenylprop-2-ynyl)piperazin-1-yl]-1,2,4-thiadiazole?
The InChIKey is RRPYMXXQOVNQKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4S/c1-3-8-18(9-4-1)10-7-13-24-14-16-25(17-15-24)21-22-20(23-26-21)19-11-5-2-6-12-19/h1-6,8-9,11-12H,13-17H2.
What are the key properties of 3-phenyl-5-[4-(3-phenylprop-2-ynyl)piperazin-1-yl]-1,2,4-thiadiazole?
3-phenyl-5-[4-(3-phenylprop-2-ynyl)piperazin-1-yl]-1,2,4-thiadiazole has a molecular weight of 360.49 g/mol, XLogP of 3.38, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-5-[4-(3-phenylprop-2-ynyl)piperazin-1-yl]-1,2,4-thiadiazole is sourced from PubChem (CID 68528255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).