C13H16N4S — CID 2737169
5-(1,4-diazepan-1-yl)-3-phenyl-1,2,4-thiadiazole (PubChem CID 2737169) has the molecular formula C13H16N4S and a molecular weight of 260.37 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-yl)-3-phenyl-1,2,4-thiadiazole.
| Compound Name | 5-(1,4-diazepan-1-yl)-3-phenyl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 2737169 |
| Molecular Formula | C13H16N4S |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 5-(1,4-diazepan-1-yl)-3-phenyl-1,2,4-thiadiazole |
| SMILES | c1ccc(-c2nsc(N3CCCNCC3)n2)cc1 |
| InChI | InChI=1S/C13H16N4S/c1-2-5-11(6-3-1)12-15-13(18-16-12)17-9-4-7-14-8-10-17/h1-3,5-6,14H,4,7-10H2 |
| InChIKey | IENGAZSTLAONAR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |