C16H21N — CID 11021734
(2S,3R)-2,3-dimethyl-1-(3-phenylprop-2-ynyl)piperidine (PubChem CID 11021734) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is (2S,3R)-2,3-dimethyl-1-(3-phenylprop-2-ynyl)piperidine.
| Compound Name | (2S,3R)-2,3-dimethyl-1-(3-phenylprop-2-ynyl)piperidine |
|---|---|
| PubChem CID | 11021734 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (2S,3R)-2,3-dimethyl-1-(3-phenylprop-2-ynyl)piperidine |
| SMILES | C[C@@H]1CCCN(CC#Cc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C16H21N/c1-14-8-6-12-17(15(14)2)13-7-11-16-9-4-3-5-10-16/h3-5,9-10,14-15H,6,8,12-13H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | YBVPKXXAECZVRA-CABCVRRESA-N |
| XLogP | 3.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|