C16H22N2O — CID 62123204
3-[2-(2,3-dimethylpiperidin-1-yl)ethoxy]benzonitrile (PubChem CID 62123204) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 3-[2-(2,3-dimethylpiperidin-1-yl)ethoxy]benzonitrile.
| Compound Name | 3-[2-(2,3-dimethylpiperidin-1-yl)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 62123204 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 3-[2-(2,3-dimethylpiperidin-1-yl)ethoxy]benzonitrile |
| SMILES | CC1CCCN(CCOc2cccc(C#N)c2)C1C |
| InChI | InChI=1S/C16H22N2O/c1-13-5-4-8-18(14(13)2)9-10-19-16-7-3-6-15(11-16)12-17/h3,6-7,11,13-14H,4-5,8-10H2,1-2H3 |
| InChIKey | HGCOIQWQRPWZFN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |