C16H20N2O3 — CID 97062500
methyl (2R)-1-[3-(3-cyanophenoxy)propyl]pyrrolidine-2-carboxylate (PubChem CID 97062500) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is methyl (2R)-1-[3-(3-cyanophenoxy)propyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2R)-1-[3-(3-cyanophenoxy)propyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 97062500 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | methyl (2R)-1-[3-(3-cyanophenoxy)propyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN1CCCOc1cccc(C#N)c1 |
| InChI | InChI=1S/C16H20N2O3/c1-20-16(19)15-7-3-8-18(15)9-4-10-21-14-6-2-5-13(11-14)12-17/h2,5-6,11,15H,3-4,7-10H2,1H3/t15-/m1/s1 |
| InChIKey | YIWLQANMUMVDGK-OAHLLOKOSA-N |
| XLogP | 1.96 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|