C17H23N3O2 — CID 97228605
2-[(2R)-1-[3-(3-cyanophenoxy)propyl]piperidin-2-yl]acetamide (PubChem CID 97228605) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[(2R)-1-[3-(3-cyanophenoxy)propyl]piperidin-2-yl]acetamide.
| Compound Name | 2-[(2R)-1-[3-(3-cyanophenoxy)propyl]piperidin-2-yl]acetamide |
|---|---|
| PubChem CID | 97228605 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 2-[(2R)-1-[3-(3-cyanophenoxy)propyl]piperidin-2-yl]acetamide |
| SMILES | N#Cc1cccc(OCCCN2CCCC[C@@H]2CC(N)=O)c1 |
| InChI | InChI=1S/C17H23N3O2/c18-13-14-5-3-7-16(11-14)22-10-4-9-20-8-2-1-6-15(20)12-17(19)21/h3,5,7,11,15H,1-2,4,6,8-10,12H2,(H2,19,21)/t15-/m1/s1 |
| InChIKey | HIJRESUWPTWJMP-OAHLLOKOSA-N |
| XLogP | 2.06 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|