C19H28N2 — CID 63848832
2-methyl-N-[[1-(3-phenylprop-2-ynyl)piperidin-3-yl]methyl]propan-2-amine (PubChem CID 63848832) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 2-methyl-N-[[1-(3-phenylprop-2-ynyl)piperidin-3-yl]methyl]propan-2-amine.
| Compound Name | 2-methyl-N-[[1-(3-phenylprop-2-ynyl)piperidin-3-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 63848832 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 2-methyl-N-[[1-(3-phenylprop-2-ynyl)piperidin-3-yl]methyl]propan-2-amine |
| SMILES | CC(C)(C)NCC1CCCN(CC#Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H28N2/c1-19(2,3)20-15-18-12-8-14-21(16-18)13-7-11-17-9-5-4-6-10-17/h4-6,9-10,18,20H,8,12-16H2,1-3H3 |
| InChIKey | PFBCSVSFYFBTNS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|