C19H24O4 — CID 135086074
2-[2,2-dimethyl-5-(4-phenylmethoxybut-2-ynyl)-1,3-dioxan-5-yl]acetaldehyde (PubChem CID 135086074) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-[2,2-dimethyl-5-(4-phenylmethoxybut-2-ynyl)-1,3-dioxan-5-yl]acetaldehyde.
| Compound Name | 2-[2,2-dimethyl-5-(4-phenylmethoxybut-2-ynyl)-1,3-dioxan-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 135086074 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 2-[2,2-dimethyl-5-(4-phenylmethoxybut-2-ynyl)-1,3-dioxan-5-yl]acetaldehyde |
| SMILES | CC1(C)OCC(CC#CCOCc2ccccc2)(CC=O)CO1 |
| InChI | InChI=1S/C19H24O4/c1-18(2)22-15-19(11-12-20,16-23-18)10-6-7-13-21-14-17-8-4-3-5-9-17/h3-5,8-9,12H,10-11,13-16H2,1-2H3 |
| InChIKey | CCINVXPAOYJOJG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|