C22H28O4 — CID 135064602
1-(5-but-2-ynyl-2,2-dimethyl-1,3-dioxan-5-yl)-3-phenylmethoxypenta-3,4-dien-2-ol (PubChem CID 135064602) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is 1-(5-but-2-ynyl-2,2-dimethyl-1,3-dioxan-5-yl)-3-phenylmethoxypenta-3,4-dien-2-ol.
| Compound Name | 1-(5-but-2-ynyl-2,2-dimethyl-1,3-dioxan-5-yl)-3-phenylmethoxypenta-3,4-dien-2-ol |
|---|---|
| PubChem CID | 135064602 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 1-(5-but-2-ynyl-2,2-dimethyl-1,3-dioxan-5-yl)-3-phenylmethoxypenta-3,4-dien-2-ol |
| SMILES | C=C=C(OCc1ccccc1)C(O)CC1(CC#CC)COC(C)(C)OC1 |
| InChI | InChI=1S/C22H28O4/c1-5-7-13-22(16-25-21(3,4)26-17-22)14-19(23)20(6-2)24-15-18-11-9-8-10-12-18/h8-12,19,23H,2,13-17H2,1,3-4H3 |
| InChIKey | OIJSJZXLGBIPOQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|