C18H22O3 — CID 134940397
[(5E)-5-methyl-3-phenylmethoxyocta-1,2,5-trien-4-yl] acetate (PubChem CID 134940397) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is [(5E)-5-methyl-3-phenylmethoxyocta-1,2,5-trien-4-yl] acetate.
| Compound Name | [(5E)-5-methyl-3-phenylmethoxyocta-1,2,5-trien-4-yl] acetate |
|---|---|
| PubChem CID | 134940397 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | [(5E)-5-methyl-3-phenylmethoxyocta-1,2,5-trien-4-yl] acetate |
| SMILES | C=C=C(OCc1ccccc1)C(OC(C)=O)/C(C)=C/CC |
| InChI | InChI=1S/C18H22O3/c1-5-10-14(3)18(21-15(4)19)17(6-2)20-13-16-11-8-7-9-12-16/h7-12,18H,2,5,13H2,1,3-4H3/b14-10+ |
| InChIKey | WKAAEBLIMWGXOS-GXDHUFHOSA-N |
| XLogP | 4.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|