C24H28O3 — CID 11810625
(2R,5R)-2-(phenylmethoxymethyl)-5-(5-phenylmethoxypent-3-ynyl)oxolane (PubChem CID 11810625) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is (2R,5R)-2-(phenylmethoxymethyl)-5-(5-phenylmethoxypent-3-ynyl)oxolane.
| Compound Name | (2R,5R)-2-(phenylmethoxymethyl)-5-(5-phenylmethoxypent-3-ynyl)oxolane |
|---|---|
| PubChem CID | 11810625 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | (2R,5R)-2-(phenylmethoxymethyl)-5-(5-phenylmethoxypent-3-ynyl)oxolane |
| SMILES | C(#CCOCc1ccccc1)CC[C@@H]1CC[C@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C24H28O3/c1-4-10-21(11-5-1)18-25-17-9-3-8-14-23-15-16-24(27-23)20-26-19-22-12-6-2-7-13-22/h1-2,4-7,10-13,23-24H,8,14-20H2/t23-,24-/m1/s1 |
| InChIKey | HEURAGZSBPQWLI-DNQXCXABSA-N |
| XLogP | 4.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|