C42H60N4O8-2 — CID 19892333
2,2-bis[2,2,6,6-tetramethyl-1-(phenylcarbamoyloxy)piperidin-4-yl]decanedioate (PubChem CID 19892333) has the molecular formula C42H60N4O8-2 and a molecular weight of 748.96 g/mol. Its IUPAC name is 2,2-bis[2,2,6,6-tetramethyl-1-(phenylcarbamoyloxy)piperidin-4-yl]decanedioate.
| Compound Name | 2,2-bis[2,2,6,6-tetramethyl-1-(phenylcarbamoyloxy)piperidin-4-yl]decanedioate |
|---|---|
| PubChem CID | 19892333 |
| Molecular Formula | C42H60N4O8-2 |
| Molecular Weight | 748.96 g/mol |
| Exact Mass | 748.44 |
| IUPAC Name | 2,2-bis[2,2,6,6-tetramethyl-1-(phenylcarbamoyloxy)piperidin-4-yl]decanedioate |
| SMILES | CC1(C)CC(C(CCCCCCCC(=O)[O-])(C(=O)[O-])C2CC(C)(C)N(OC(=O)Nc3ccccc3)C(C)(C)C2)CC(C)(C)N1OC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C42H62N4O8/c1-38(2)26-30(27-39(3,4)45(38)53-36(51)43-32-20-14-12-15-21-32)42(35(49)50,25-19-11-9-10-18-24-34(47)48)31-28-40(5,6)46(41(7,8)29-31)54-37(52)44-33-22-16-13-17-23-33/h12-17,20-23,30-31H,9-11,18-19,24-29H2,1-8H3,(H,43,51)(H,44,52)(H,47,48)(H,49,50)/p-2 |
| InChIKey | UJXKOGLHINCJBE-UHFFFAOYSA-L |
| XLogP | 7.07 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.96 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|