C20H30N2O2 — CID 21409714
2,2,6,6-tetramethyl-1-(3-oxobutyl)-N-phenylpiperidine-4-carboxamide (PubChem CID 21409714) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-(3-oxobutyl)-N-phenylpiperidine-4-carboxamide.
| Compound Name | 2,2,6,6-tetramethyl-1-(3-oxobutyl)-N-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 21409714 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-(3-oxobutyl)-N-phenylpiperidine-4-carboxamide |
| SMILES | CC(=O)CCN1C(C)(C)CC(C(=O)Nc2ccccc2)CC1(C)C |
| InChI | InChI=1S/C20H30N2O2/c1-15(23)11-12-22-19(2,3)13-16(14-20(22,4)5)18(24)21-17-9-7-6-8-10-17/h6-10,16H,11-14H2,1-5H3,(H,21,24) |
| InChIKey | KAZWCCQQUNQCPP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |