C48H70N2O12-2 — CID 20510558
2,2-bis[3-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)-2,2-dihydroxypropyl]decanedioate (PubChem CID 20510558) has the molecular formula C48H70N2O12-2 and a molecular weight of 867.09 g/mol. Its IUPAC name is 2,2-bis[3-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)-2,2-dihydroxypropyl]decanedioate.
| Compound Name | 2,2-bis[3-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)-2,2-dihydroxypropyl]decanedioate |
|---|---|
| PubChem CID | 20510558 |
| Molecular Formula | C48H70N2O12-2 |
| Molecular Weight | 867.09 g/mol |
| Exact Mass | 866.49 |
| IUPAC Name | 2,2-bis[3-(4-benzoyloxy-2,2,6,6-tetramethylpiperidin-1-yl)-2,2-dihydroxypropyl]decanedioate |
| SMILES | CC1(C)CC(OC(=O)c2ccccc2)CC(C)(C)N1CC(O)(O)CC(CCCCCCCC(=O)[O-])(CC(O)(O)CN1C(C)(C)CC(OC(=O)c2ccccc2)CC1(C)C)C(=O)[O-] |
| InChI | InChI=1S/C48H72N2O12/c1-42(2)26-36(61-39(53)34-20-14-12-15-21-34)27-43(3,4)49(42)32-47(57,58)30-46(41(55)56,25-19-11-9-10-18-24-38(51)52)31-48(59,60)33-50-44(5,6)28-37(29-45(50,7)8)62-40(54)35-22-16-13-17-23-35/h12-17,20-23,36-37,57-60H,9-11,18-19,24-33H2,1-8H3,(H,51,52)(H,55,56)/p-2 |
| InChIKey | QPVBRWBCGJSDJW-UHFFFAOYSA-L |
| XLogP | 4.10 |
| TPSA | 220.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.09 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|