C31H51N2O6+ — CID 149123947
[2,2,7,7-tetramethyl-4-[4-oxo-4-[2,2,7,7-tetramethyl-1-(4-methylphenoxy)azepan-4-yl]oxybutanoyl]oxyazepan-1-yl]oxidanium (PubChem CID 149123947) has the molecular formula C31H51N2O6+ and a molecular weight of 547.76 g/mol. Its IUPAC name is [2,2,7,7-tetramethyl-4-[4-oxo-4-[2,2,7,7-tetramethyl-1-(4-methylphenoxy)azepan-4-yl]oxybutanoyl]oxyazepan-1-yl]oxidanium.
| Compound Name | [2,2,7,7-tetramethyl-4-[4-oxo-4-[2,2,7,7-tetramethyl-1-(4-methylphenoxy)azepan-4-yl]oxybutanoyl]oxyazepan-1-yl]oxidanium |
|---|---|
| PubChem CID | 149123947 |
| Molecular Formula | C31H51N2O6+ |
| Molecular Weight | 547.76 g/mol |
| Exact Mass | 547.37 |
| IUPAC Name | [2,2,7,7-tetramethyl-4-[4-oxo-4-[2,2,7,7-tetramethyl-1-(4-methylphenoxy)azepan-4-yl]oxybutanoyl]oxyazepan-1-yl]oxidanium |
| SMILES | Cc1ccc(ON2C(C)(C)CCC(OC(=O)CCC(=O)OC3CCC(C)(C)N([OH2+])C(C)(C)C3)CC2(C)C)cc1 |
| InChI | InChI=1S/C31H50N2O6/c1-22-10-12-23(13-11-22)39-33-29(4,5)19-17-25(21-31(33,8)9)38-27(35)15-14-26(34)37-24-16-18-28(2,3)32(36)30(6,7)20-24/h10-13,24-25,36H,14-21H2,1-9H3/p+1 |
| InChIKey | RANCINVYNDBTSS-UHFFFAOYSA-O |
| XLogP | 5.62 |
| TPSA | 91.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.76 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|