C55H82NO4P — CID 171471913
(Z)-18-[2,2,5,5-tetramethyl-3-(10-triphenylphosphaniumyldecoxycarbonyl)pyrrolidin-1-yl]octadec-9-enoate (PubChem CID 171471913) has the molecular formula C55H82NO4P and a molecular weight of 852.24 g/mol. Its IUPAC name is (Z)-18-[2,2,5,5-tetramethyl-3-(10-triphenylphosphaniumyldecoxycarbonyl)pyrrolidin-1-yl]octadec-9-enoate.
| Compound Name | (Z)-18-[2,2,5,5-tetramethyl-3-(10-triphenylphosphaniumyldecoxycarbonyl)pyrrolidin-1-yl]octadec-9-enoate |
|---|---|
| PubChem CID | 171471913 |
| Molecular Formula | C55H82NO4P |
| Molecular Weight | 852.24 g/mol |
| Exact Mass | 851.60 |
| IUPAC Name | (Z)-18-[2,2,5,5-tetramethyl-3-(10-triphenylphosphaniumyldecoxycarbonyl)pyrrolidin-1-yl]octadec-9-enoate |
| SMILES | CC1(C)CC(C(=O)OCCCCCCCCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)C(C)(C)N1CCCCCCCC/C=C\CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C55H82NO4P/c1-54(2)47-51(55(3,4)56(54)44-34-21-17-13-11-9-7-5-6-8-10-12-16-20-33-43-52(57)58)53(59)60-45-35-22-18-14-15-19-23-36-46-61(48-37-27-24-28-38-48,49-39-29-25-30-40-49)50-41-31-26-32-42-50/h5-6,24-32,37-42,51H,7-23,33-36,43-47H2,1-4H3/b6-5- |
| InChIKey | VBDKIOPMKZRALX-WAYWQWQTSA-N |
| XLogP | 12.29 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.24 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|