C33H43BrN2O2P — CID 51001694
CID 51001694 (PubChem CID 51001694) has the molecular formula C33H43BrN2O2P and a molecular weight of 610.60 g/mol.
| Compound Name | CID 51001694 |
|---|---|
| PubChem CID | 51001694 |
| Molecular Formula | C33H43BrN2O2P |
| Molecular Weight | 610.60 g/mol |
| Exact Mass | 609.22 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(CNC(=O)CCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)CC(C)(C)N1[O].[Br-] |
| InChI | InChI=1S/C33H42N2O2P.BrH/c1-32(2)24-27(25-33(3,4)35(32)37)26-34-31(36)22-14-15-23-38(28-16-8-5-9-17-28,29-18-10-6-11-19-29)30-20-12-7-13-21-30;/h5-13,16-21,27H,14-15,22-26H2,1-4H3;1H |
| InChIKey | UOFRSKGTJUYLTE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.60 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|