C32H43BrNO2P — CID 132989553
5-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypentyl-triphenylphosphanium bromide (PubChem CID 132989553) has the molecular formula C32H43BrNO2P and a molecular weight of 584.58 g/mol. Its IUPAC name is 5-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypentyl-triphenylphosphanium bromide.
| Compound Name | 5-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypentyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 132989553 |
| Molecular Formula | C32H43BrNO2P |
| Molecular Weight | 584.58 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | 5-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypentyl-triphenylphosphanium bromide |
| SMILES | CC1(C)CC(OCCCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)CC(C)(C)N1O.[Br-] |
| InChI | InChI=1S/C32H43NO2P.BrH/c1-31(2)25-27(26-32(3,4)33(31)34)35-23-15-8-16-24-36(28-17-9-5-10-18-28,29-19-11-6-12-20-29)30-21-13-7-14-22-30;/h5-7,9-14,17-22,27,34H,8,15-16,23-26H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | PAESSHGSOHSIFC-UHFFFAOYSA-M |
| XLogP | 3.58 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.58 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|