C35H39NO4P+ — CID 58948114
[4-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonyloxymethyl]phenyl]-triphenylphosphanium (PubChem CID 58948114) has the molecular formula C35H39NO4P+ and a molecular weight of 568.67 g/mol. Its IUPAC name is [4-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonyloxymethyl]phenyl]-triphenylphosphanium.
| Compound Name | [4-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonyloxymethyl]phenyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 58948114 |
| Molecular Formula | C35H39NO4P+ |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | [4-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonyloxymethyl]phenyl]-triphenylphosphanium |
| SMILES | CC1(C)CC(OC(=O)OCc2ccc([P+](c3ccccc3)(c3ccccc3)c3ccccc3)cc2)CC(C)(C)N1O |
| InChI | InChI=1S/C35H39NO4P/c1-34(2)24-28(25-35(3,4)36(34)38)40-33(37)39-26-27-20-22-32(23-21-27)41(29-14-8-5-9-15-29,30-16-10-6-11-17-30)31-18-12-7-13-19-31/h5-23,28,38H,24-26H2,1-4H3/q+1 |
| InChIKey | TXARCDAKHUJZPQ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|