About (2-ethyl-1-hydroxy-2,6,6-trimethylpiperidin-4-yl) furan-2-carboxylate
(2-ethyl-1-hydroxy-2,6,6-trimethylpiperidin-4-yl) furan-2-carboxylate (PubChem CID 142832127) has the molecular formula C15H23NO4
and a molecular weight of 281.35 g/mol. Its IUPAC name is (2-ethyl-1-hydroxy-2,6,6-trimethylpiperidin-4-yl) furan-2-carboxylate.
Molecular Properties
| Compound Name | (2-ethyl-1-hydroxy-2,6,6-trimethylpiperidin-4-yl) furan-2-carboxylate |
| PubChem CID | 142832127 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (2-ethyl-1-hydroxy-2,6,6-trimethylpiperidin-4-yl) furan-2-carboxylate |
| SMILES | CCC1(C)CC(OC(=O)c2ccco2)CC(C)(C)N1O |
| InChI | InChI=1S/C15H23NO4/c1-5-15(4)10-11(9-14(2,3)16(15)18)20-13(17)12-7-6-8-19-12/h6-8,11,18H,5,9-10H2,1-4H3 |
| InChIKey | NPMNYYGHZKJYSI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-ethyl-1-hydroxy-2,6,6-trimethylpiperidin-4-yl) furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-1-hydroxy-2,6,6-trimethylpiperidin-4-yl) furan-2-carboxylate?
The IUPAC name of (2-ethyl-1-hydroxy-2,6,6-trimethylpiperidin-4-yl) furan-2-carboxylate (CID 142832127) is (2-ethyl-1-hydroxy-2,6,6-trimethylpiperidin-4-yl) furan-2-carboxylate.
What is the SMILES notation for (2-ethyl-1-hydroxy-2,6,6-trimethylpiperidin-4-yl) furan-2-carboxylate?
The canonical SMILES for (2-ethyl-1-hydroxy-2,6,6-trimethylpiperidin-4-yl) furan-2-carboxylate is CCC1(C)CC(OC(=O)c2ccco2)CC(C)(C)N1O.
What is the InChIKey of (2-ethyl-1-hydroxy-2,6,6-trimethylpiperidin-4-yl) furan-2-carboxylate?
The InChIKey is NPMNYYGHZKJYSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO4/c1-5-15(4)10-11(9-14(2,3)16(15)18)20-13(17)12-7-6-8-19-12/h6-8,11,18H,5,9-10H2,1-4H3.
What are the key properties of (2-ethyl-1-hydroxy-2,6,6-trimethylpiperidin-4-yl) furan-2-carboxylate?
(2-ethyl-1-hydroxy-2,6,6-trimethylpiperidin-4-yl) furan-2-carboxylate has a molecular weight of 281.35 g/mol, XLogP of 3.24, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-1-hydroxy-2,6,6-trimethylpiperidin-4-yl) furan-2-carboxylate is sourced from PubChem (CID 142832127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).