C28H51N3O6 — CID 122416855
[2-[1,3-bis[hexyl(methyl)amino]propan-2-yloxycarbonylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate (PubChem CID 122416855) has the molecular formula C28H51N3O6 and a molecular weight of 525.73 g/mol. Its IUPAC name is [2-[1,3-bis[hexyl(methyl)amino]propan-2-yloxycarbonylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate.
| Compound Name | [2-[1,3-bis[hexyl(methyl)amino]propan-2-yloxycarbonylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate |
|---|---|
| PubChem CID | 122416855 |
| Molecular Formula | C28H51N3O6 |
| Molecular Weight | 525.73 g/mol |
| Exact Mass | 525.38 |
| IUPAC Name | [2-[1,3-bis[hexyl(methyl)amino]propan-2-yloxycarbonylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)(COC(=O)C=C)NC(=O)OC(CN(C)CCCCCC)CN(C)CCCCCC |
| InChI | InChI=1S/C28H51N3O6/c1-8-12-14-16-18-30(6)20-24(21-31(7)19-17-15-13-9-2)37-27(34)29-28(5,22-35-25(32)10-3)23-36-26(33)11-4/h10-11,24H,3-4,8-9,12-23H2,1-2,5-7H3,(H,29,34) |
| InChIKey | GTZLJTKKHWHDAO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.73 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|