C20H33NO7 — CID 126547484
[2-[[(2S)-2-(3-hydroxy-2,3-dimethylpentoxy)propanoyl]amino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate (PubChem CID 126547484) has the molecular formula C20H33NO7 and a molecular weight of 399.48 g/mol. Its IUPAC name is [2-[[(2S)-2-(3-hydroxy-2,3-dimethylpentoxy)propanoyl]amino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate.
| Compound Name | [2-[[(2S)-2-(3-hydroxy-2,3-dimethylpentoxy)propanoyl]amino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate |
|---|---|
| PubChem CID | 126547484 |
| Molecular Formula | C20H33NO7 |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | [2-[[(2S)-2-(3-hydroxy-2,3-dimethylpentoxy)propanoyl]amino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)(COC(=O)C=C)NC(=O)[C@H](C)OCC(C)C(C)(O)CC |
| InChI | InChI=1S/C20H33NO7/c1-8-16(22)27-12-19(6,13-28-17(23)9-2)21-18(24)15(5)26-11-14(4)20(7,25)10-3/h8-9,14-15,25H,1-2,10-13H2,3-7H3,(H,21,24)/t14?,15-,20?/m0/s1 |
| InChIKey | JBEZELDQIMTBHO-CHWWFWEZSA-N |
| XLogP | 1.52 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|