C13H22ClNO2 — CID 141256666
(1-chloro-2,2,6,6-tetramethylpiperidin-4-yl)methyl prop-2-enoate (PubChem CID 141256666) has the molecular formula C13H22ClNO2 and a molecular weight of 259.78 g/mol. Its IUPAC name is (1-chloro-2,2,6,6-tetramethylpiperidin-4-yl)methyl prop-2-enoate.
| Compound Name | (1-chloro-2,2,6,6-tetramethylpiperidin-4-yl)methyl prop-2-enoate |
|---|---|
| PubChem CID | 141256666 |
| Molecular Formula | C13H22ClNO2 |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | (1-chloro-2,2,6,6-tetramethylpiperidin-4-yl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1CC(C)(C)N(Cl)C(C)(C)C1 |
| InChI | InChI=1S/C13H22ClNO2/c1-6-11(16)17-9-10-7-12(2,3)15(14)13(4,5)8-10/h6,10H,1,7-9H2,2-5H3 |
| InChIKey | DBOJEZZHYYJHNA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|