C15H24N2O2 — CID 141174830
(1,2,2,6,6-pentamethylpiperidin-4-yl)methyl 2-cyanoprop-2-enoate (PubChem CID 141174830) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is (1,2,2,6,6-pentamethylpiperidin-4-yl)methyl 2-cyanoprop-2-enoate.
| Compound Name | (1,2,2,6,6-pentamethylpiperidin-4-yl)methyl 2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 141174830 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | (1,2,2,6,6-pentamethylpiperidin-4-yl)methyl 2-cyanoprop-2-enoate |
| SMILES | C=C(C#N)C(=O)OCC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C15H24N2O2/c1-11(9-16)13(18)19-10-12-7-14(2,3)17(6)15(4,5)8-12/h12H,1,7-8,10H2,2-6H3 |
| InChIKey | CMRFKMLZYDPAHJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|