C11H20N2O5 — CID 141288797
[1-(dimethoxymethyl)-2-hydroxy-1,3-diazinan-5-yl]methyl prop-2-enoate (PubChem CID 141288797) has the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. Its IUPAC name is [1-(dimethoxymethyl)-2-hydroxy-1,3-diazinan-5-yl]methyl prop-2-enoate.
| Compound Name | [1-(dimethoxymethyl)-2-hydroxy-1,3-diazinan-5-yl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 141288797 |
| Molecular Formula | C11H20N2O5 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | [1-(dimethoxymethyl)-2-hydroxy-1,3-diazinan-5-yl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1CNC(O)N(C(OC)OC)C1 |
| InChI | InChI=1S/C11H20N2O5/c1-4-9(14)18-7-8-5-12-10(15)13(6-8)11(16-2)17-3/h4,8,10-12,15H,1,5-7H2,2-3H3 |
| InChIKey | VXKNPOYBPIGWSL-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|