C46H89N3O3 — CID 139317451
1-butyl-4-[4-(1-butyl-2,2,6,6-tetramethylpiperidin-4-yl)oxy-2-(2,2,6,6-tetramethyl-1-pentylpiperidin-4-yl)oxycyclohexyl]oxy-2,2,6,6-tetramethylpiperidine (PubChem CID 139317451) has the molecular formula C46H89N3O3 and a molecular weight of 732.24 g/mol. Its IUPAC name is 1-butyl-4-[4-(1-butyl-2,2,6,6-tetramethylpiperidin-4-yl)oxy-2-(2,2,6,6-tetramethyl-1-pentylpiperidin-4-yl)oxycyclohexyl]oxy-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-butyl-4-[4-(1-butyl-2,2,6,6-tetramethylpiperidin-4-yl)oxy-2-(2,2,6,6-tetramethyl-1-pentylpiperidin-4-yl)oxycyclohexyl]oxy-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 139317451 |
| Molecular Formula | C46H89N3O3 |
| Molecular Weight | 732.24 g/mol |
| Exact Mass | 731.69 |
| IUPAC Name | 1-butyl-4-[4-(1-butyl-2,2,6,6-tetramethylpiperidin-4-yl)oxy-2-(2,2,6,6-tetramethyl-1-pentylpiperidin-4-yl)oxycyclohexyl]oxy-2,2,6,6-tetramethylpiperidine |
| SMILES | CCCCCN1C(C)(C)CC(OC2CC(OC3CC(C)(C)N(CCCC)C(C)(C)C3)CCC2OC2CC(C)(C)N(CCCC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C46H89N3O3/c1-16-19-22-27-49-45(12,13)33-38(34-46(49,14)15)52-40-28-35(50-36-29-41(4,5)47(25-20-17-2)42(6,7)30-36)23-24-39(40)51-37-31-43(8,9)48(26-21-18-3)44(10,11)32-37/h35-40H,16-34H2,1-15H3 |
| InChIKey | YCYKNTSUBZSZTK-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.24 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|