C32H50N2O5 — CID 90347319
bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[2-[4-(hydroxymethyl)phenyl]ethenyl]propanedioate (PubChem CID 90347319) has the molecular formula C32H50N2O5 and a molecular weight of 542.76 g/mol. Its IUPAC name is bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[2-[4-(hydroxymethyl)phenyl]ethenyl]propanedioate.
| Compound Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[2-[4-(hydroxymethyl)phenyl]ethenyl]propanedioate |
|---|---|
| PubChem CID | 90347319 |
| Molecular Formula | C32H50N2O5 |
| Molecular Weight | 542.76 g/mol |
| Exact Mass | 542.37 |
| IUPAC Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[2-[4-(hydroxymethyl)phenyl]ethenyl]propanedioate |
| SMILES | CN1C(C)(C)CC(OC(=O)C(C=Cc2ccc(CO)cc2)C(=O)OC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C32H50N2O5/c1-29(2)17-24(18-30(3,4)33(29)9)38-27(36)26(16-15-22-11-13-23(21-35)14-12-22)28(37)39-25-19-31(5,6)34(10)32(7,8)20-25/h11-16,24-26,35H,17-21H2,1-10H3 |
| InChIKey | VZMKTCVWELDUIT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.76 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|