C42H72N2O5 — CID 67788022
3-[1-(3,5-ditert-butylphenyl)-1-hydroxy-2-methyl-4,4-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)butan-2-yl]oxy-3-oxopropanoic acid (PubChem CID 67788022) has the molecular formula C42H72N2O5 and a molecular weight of 685.05 g/mol. Its IUPAC name is 3-[1-(3,5-ditert-butylphenyl)-1-hydroxy-2-methyl-4,4-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)butan-2-yl]oxy-3-oxopropanoic acid.
| Compound Name | 3-[1-(3,5-ditert-butylphenyl)-1-hydroxy-2-methyl-4,4-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)butan-2-yl]oxy-3-oxopropanoic acid |
|---|---|
| PubChem CID | 67788022 |
| Molecular Formula | C42H72N2O5 |
| Molecular Weight | 685.05 g/mol |
| Exact Mass | 684.54 |
| IUPAC Name | 3-[1-(3,5-ditert-butylphenyl)-1-hydroxy-2-methyl-4,4-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)butan-2-yl]oxy-3-oxopropanoic acid |
| SMILES | CN1C(C)(C)CC(C(CC(C)(OC(=O)CC(=O)O)C(O)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)C2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C42H72N2O5/c1-36(2,3)30-18-27(19-31(20-30)37(4,5)6)35(48)42(15,49-34(47)21-33(45)46)26-32(28-22-38(7,8)43(16)39(9,10)23-28)29-24-40(11,12)44(17)41(13,14)25-29/h18-20,28-29,32,35,48H,21-26H2,1-17H3,(H,45,46) |
| InChIKey | CVJJKFVFXMCOQX-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.05 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|