C38H70N2O6 — CID 153219255
1-O-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) 10-O-(2,2,6,6-tetramethyl-1-non-1-en-2-yloxypiperidin-4-yl) decanedioate (PubChem CID 153219255) has the molecular formula C38H70N2O6 and a molecular weight of 650.99 g/mol. Its IUPAC name is 1-O-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) 10-O-(2,2,6,6-tetramethyl-1-non-1-en-2-yloxypiperidin-4-yl) decanedioate.
| Compound Name | 1-O-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) 10-O-(2,2,6,6-tetramethyl-1-non-1-en-2-yloxypiperidin-4-yl) decanedioate |
|---|---|
| PubChem CID | 153219255 |
| Molecular Formula | C38H70N2O6 |
| Molecular Weight | 650.99 g/mol |
| Exact Mass | 650.52 |
| IUPAC Name | 1-O-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) 10-O-(2,2,6,6-tetramethyl-1-non-1-en-2-yloxypiperidin-4-yl) decanedioate |
| SMILES | C=C(CCCCCCC)ON1C(C)(C)CC(OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)N(OC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C38H70N2O6/c1-12-13-14-17-20-23-30(2)46-40-37(7,8)28-32(29-38(40,9)10)45-34(42)25-22-19-16-15-18-21-24-33(41)44-31-26-35(3,4)39(43-11)36(5,6)27-31/h31-32H,2,12-29H2,1,3-11H3 |
| InChIKey | WNICCBMRTHCFGH-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.99 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|