C11H15NS — CID 89065677
8-thiophen-2-yl-8-azabicyclo[3.2.1]octane (PubChem CID 89065677) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is 8-thiophen-2-yl-8-azabicyclo[3.2.1]octane.
| Compound Name | 8-thiophen-2-yl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 89065677 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 8-thiophen-2-yl-8-azabicyclo[3.2.1]octane |
| SMILES | c1csc(N2C3CCCC2CC3)c1 |
| InChI | InChI=1S/C11H15NS/c1-3-9-6-7-10(4-1)12(9)11-5-2-8-13-11/h2,5,8-10H,1,3-4,6-7H2 |
| InChIKey | NNLONAMSMWOUKQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |