C35H50N6O3 — CID 167027144
3-[4-[4-[2-[4-[1-(4-amino-5-methoxy-2-methylphenyl)piperidin-4-yl]piperazin-1-yl]ethyl]piperidin-1-yl]phenyl]piperidine-2,6-dione (PubChem CID 167027144) has the molecular formula C35H50N6O3 and a molecular weight of 602.82 g/mol. Its IUPAC name is 3-[4-[4-[2-[4-[1-(4-amino-5-methoxy-2-methylphenyl)piperidin-4-yl]piperazin-1-yl]ethyl]piperidin-1-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[2-[4-[1-(4-amino-5-methoxy-2-methylphenyl)piperidin-4-yl]piperazin-1-yl]ethyl]piperidin-1-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167027144 |
| Molecular Formula | C35H50N6O3 |
| Molecular Weight | 602.82 g/mol |
| Exact Mass | 602.39 |
| IUPAC Name | 3-[4-[4-[2-[4-[1-(4-amino-5-methoxy-2-methylphenyl)piperidin-4-yl]piperazin-1-yl]ethyl]piperidin-1-yl]phenyl]piperidine-2,6-dione |
| SMILES | COc1cc(N2CCC(N3CCN(CCC4CCN(c5ccc(C6CCC(=O)NC6=O)cc5)CC4)CC3)CC2)c(C)cc1N |
| InChI | InChI=1S/C35H50N6O3/c1-25-23-31(36)33(44-2)24-32(25)41-17-12-29(13-18-41)40-21-19-38(20-22-40)14-9-26-10-15-39(16-11-26)28-5-3-27(4-6-28)30-7-8-34(42)37-35(30)43/h3-6,23-24,26,29-30H,7-22,36H2,1-2H3,(H,37,42,43) |
| InChIKey | SGJBLPGBOLCMDQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.82 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|