C20H33N3O3S — CID 59452961
2-methoxy-4-[4-[4-(2-methylsulfonylethyl)piperidin-1-yl]piperidin-1-yl]aniline (PubChem CID 59452961) has the molecular formula C20H33N3O3S and a molecular weight of 395.57 g/mol. Its IUPAC name is 2-methoxy-4-[4-[4-(2-methylsulfonylethyl)piperidin-1-yl]piperidin-1-yl]aniline.
| Compound Name | 2-methoxy-4-[4-[4-(2-methylsulfonylethyl)piperidin-1-yl]piperidin-1-yl]aniline |
|---|---|
| PubChem CID | 59452961 |
| Molecular Formula | C20H33N3O3S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 2-methoxy-4-[4-[4-(2-methylsulfonylethyl)piperidin-1-yl]piperidin-1-yl]aniline |
| SMILES | COc1cc(N2CCC(N3CCC(CCS(C)(=O)=O)CC3)CC2)ccc1N |
| InChI | InChI=1S/C20H33N3O3S/c1-26-20-15-18(3-4-19(20)21)23-12-7-17(8-13-23)22-10-5-16(6-11-22)9-14-27(2,24)25/h3-4,15-17H,5-14,21H2,1-2H3 |
| InChIKey | LQIAKFFSZQNDTQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|