C17H29N3O3S — CID 77158182
2-methoxy-4-[4-(2-methylsulfonylethyl)-3-propan-2-ylpiperazin-1-yl]aniline (PubChem CID 77158182) has the molecular formula C17H29N3O3S and a molecular weight of 355.50 g/mol. Its IUPAC name is 2-methoxy-4-[4-(2-methylsulfonylethyl)-3-propan-2-ylpiperazin-1-yl]aniline.
| Compound Name | 2-methoxy-4-[4-(2-methylsulfonylethyl)-3-propan-2-ylpiperazin-1-yl]aniline |
|---|---|
| PubChem CID | 77158182 |
| Molecular Formula | C17H29N3O3S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 2-methoxy-4-[4-(2-methylsulfonylethyl)-3-propan-2-ylpiperazin-1-yl]aniline |
| SMILES | COc1cc(N2CCN(CCS(C)(=O)=O)C(C(C)C)C2)ccc1N |
| InChI | InChI=1S/C17H29N3O3S/c1-13(2)16-12-20(8-7-19(16)9-10-24(4,21)22)14-5-6-15(18)17(11-14)23-3/h5-6,11,13,16H,7-10,12,18H2,1-4H3 |
| InChIKey | JVNXKSMJMPHIMA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|