C31H37FN6O5 — CID 167462668
4-[4-[2-[1-(4-amino-2-fluoro-5-methoxyphenyl)piperidin-4-yl]ethyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167462668) has the molecular formula C31H37FN6O5 and a molecular weight of 592.67 g/mol. Its IUPAC name is 4-[4-[2-[1-(4-amino-2-fluoro-5-methoxyphenyl)piperidin-4-yl]ethyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[4-[2-[1-(4-amino-2-fluoro-5-methoxyphenyl)piperidin-4-yl]ethyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167462668 |
| Molecular Formula | C31H37FN6O5 |
| Molecular Weight | 592.67 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | 4-[4-[2-[1-(4-amino-2-fluoro-5-methoxyphenyl)piperidin-4-yl]ethyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | COc1cc(N2CCC(CCN3CCN(c4cccc5c4C(=O)N(C4CCC(=O)NC4=O)C5=O)CC3)CC2)c(F)cc1N |
| InChI | InChI=1S/C31H37FN6O5/c1-43-26-18-25(21(32)17-22(26)33)36-11-8-19(9-12-36)7-10-35-13-15-37(16-14-35)23-4-2-3-20-28(23)31(42)38(30(20)41)24-5-6-27(39)34-29(24)40/h2-4,17-19,24H,5-16,33H2,1H3,(H,34,39,40) |
| InChIKey | KGTCAHSPYCGFKP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 128.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.67 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|