C34H40FN5O7S — CID 175480948
2-(2,6-dioxopiperidin-3-yl)-4-[4-[2-[1-[(1R,2R)-2-fluoro-1-hydroxy-7-methylsulfonyl-2,3-dihydro-1H-inden-4-yl]piperidin-4-yl]ethyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 175480948) has the molecular formula C34H40FN5O7S and a molecular weight of 681.79 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[4-[2-[1-[(1R,2R)-2-fluoro-1-hydroxy-7-methylsulfonyl-2,3-dihydro-1H-inden-4-yl]piperidin-4-yl]ethyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[4-[2-[1-[(1R,2R)-2-fluoro-1-hydroxy-7-methylsulfonyl-2,3-dihydro-1H-inden-4-yl]piperidin-4-yl]ethyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 175480948 |
| Molecular Formula | C34H40FN5O7S |
| Molecular Weight | 681.79 g/mol |
| Exact Mass | 681.26 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[4-[2-[1-[(1R,2R)-2-fluoro-1-hydroxy-7-methylsulfonyl-2,3-dihydro-1H-inden-4-yl]piperidin-4-yl]ethyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | CS(=O)(=O)c1ccc(N2CCC(CCN3CCN(c4cccc5c4C(=O)N(C4CCC(=O)NC4=O)C5=O)CC3)CC2)c2c1[C@@H](O)[C@H](F)C2 |
| InChI | InChI=1S/C34H40FN5O7S/c1-48(46,47)27-7-5-24(22-19-23(35)31(42)30(22)27)38-13-10-20(11-14-38)9-12-37-15-17-39(18-16-37)25-4-2-3-21-29(25)34(45)40(33(21)44)26-6-8-28(41)36-32(26)43/h2-5,7,20,23,26,31,42H,6,8-19H2,1H3,(H,36,41,43)/t23-,26?,31+/m1/s1 |
| InChIKey | WVGIDNKXDIWTFP-QVEZPXLQSA-N |
| XLogP | 1.85 |
| TPSA | 147.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.79 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|