C24H35FN6O2 — CID 167463582
3-[4-[2-(1-aminopiperidin-4-yl)-2,7-diazaspiro[3.5]nonan-7-yl]-3-fluoro-N-methylanilino]piperidine-2,6-dione (PubChem CID 167463582) has the molecular formula C24H35FN6O2 and a molecular weight of 458.58 g/mol. Its IUPAC name is 3-[4-[2-(1-aminopiperidin-4-yl)-2,7-diazaspiro[3.5]nonan-7-yl]-3-fluoro-N-methylanilino]piperidine-2,6-dione.
| Compound Name | 3-[4-[2-(1-aminopiperidin-4-yl)-2,7-diazaspiro[3.5]nonan-7-yl]-3-fluoro-N-methylanilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167463582 |
| Molecular Formula | C24H35FN6O2 |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | 3-[4-[2-(1-aminopiperidin-4-yl)-2,7-diazaspiro[3.5]nonan-7-yl]-3-fluoro-N-methylanilino]piperidine-2,6-dione |
| SMILES | CN(c1ccc(N2CCC3(CC2)CN(C2CCN(N)CC2)C3)c(F)c1)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C24H35FN6O2/c1-28(21-4-5-22(32)27-23(21)33)18-2-3-20(19(25)14-18)29-12-8-24(9-13-29)15-30(16-24)17-6-10-31(26)11-7-17/h2-3,14,17,21H,4-13,15-16,26H2,1H3,(H,27,32,33) |
| InChIKey | IFOMFUMIRHCVBD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|