C18H29N3O2 — CID 178116591
3-[4-[3-(ethylamino)piperidin-1-yl]phenyl]piperidine-2,6-dione;molecular hydrogen (PubChem CID 178116591) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 3-[4-[3-(ethylamino)piperidin-1-yl]phenyl]piperidine-2,6-dione;molecular hydrogen.
| Compound Name | 3-[4-[3-(ethylamino)piperidin-1-yl]phenyl]piperidine-2,6-dione;molecular hydrogen |
|---|---|
| PubChem CID | 178116591 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 3-[4-[3-(ethylamino)piperidin-1-yl]phenyl]piperidine-2,6-dione;molecular hydrogen |
| SMILES | CCNC1CCCN(c2ccc(C3CCC(=O)NC3=O)cc2)C1.[H][H].[H][H] |
| InChI | InChI=1S/C18H25N3O2.2H2/c1-2-19-14-4-3-11-21(12-14)15-7-5-13(6-8-15)16-9-10-17(22)20-18(16)23;;/h5-8,14,16,19H,2-4,9-12H2,1H3,(H,20,22,23);2*1H |
| InChIKey | WBBGESVBEXGWCY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|