C18H24ClN5O2 — CID 172587152
3-[1-methyl-6-[(2R)-2-methylpiperazin-4-ium-1-yl]indazol-3-yl]piperidine-2,6-dione chloride (PubChem CID 172587152) has the molecular formula C18H24ClN5O2 and a molecular weight of 377.88 g/mol. Its IUPAC name is 3-[1-methyl-6-[(2R)-2-methylpiperazin-4-ium-1-yl]indazol-3-yl]piperidine-2,6-dione chloride.
| Compound Name | 3-[1-methyl-6-[(2R)-2-methylpiperazin-4-ium-1-yl]indazol-3-yl]piperidine-2,6-dione chloride |
|---|---|
| PubChem CID | 172587152 |
| Molecular Formula | C18H24ClN5O2 |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 3-[1-methyl-6-[(2R)-2-methylpiperazin-4-ium-1-yl]indazol-3-yl]piperidine-2,6-dione chloride |
| SMILES | C[C@@H]1C[NH2+]CCN1c1ccc2c(C3CCC(=O)NC3=O)nn(C)c2c1.[Cl-] |
| InChI | InChI=1S/C18H23N5O2.ClH/c1-11-10-19-7-8-23(11)12-3-4-13-15(9-12)22(2)21-17(13)14-5-6-16(24)20-18(14)25;/h3-4,9,11,14,19H,5-8,10H2,1-2H3,(H,20,24,25);1H/t11-,14?;/m1./s1 |
| InChIKey | XUKIOIKFYYONEG-JEVWNTBDSA-N |
| XLogP | -3.13 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|