C26H36N6O2 — CID 170629865
3-[1-methyl-6-[7-(piperazin-1-ylmethyl)-2-azaspiro[3.5]nonan-2-yl]indazol-3-yl]piperidine-2,6-dione (PubChem CID 170629865) has the molecular formula C26H36N6O2 and a molecular weight of 464.61 g/mol. Its IUPAC name is 3-[1-methyl-6-[7-(piperazin-1-ylmethyl)-2-azaspiro[3.5]nonan-2-yl]indazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[1-methyl-6-[7-(piperazin-1-ylmethyl)-2-azaspiro[3.5]nonan-2-yl]indazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170629865 |
| Molecular Formula | C26H36N6O2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | 3-[1-methyl-6-[7-(piperazin-1-ylmethyl)-2-azaspiro[3.5]nonan-2-yl]indazol-3-yl]piperidine-2,6-dione |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2ccc(N3CC4(CCC(CN5CCNCC5)CC4)C3)cc21 |
| InChI | InChI=1S/C26H36N6O2/c1-30-22-14-19(2-3-20(22)24(29-30)21-4-5-23(33)28-25(21)34)32-16-26(17-32)8-6-18(7-9-26)15-31-12-10-27-11-13-31/h2-3,14,18,21,27H,4-13,15-17H2,1H3,(H,28,33,34) |
| InChIKey | HOPSOEHFEOBFCL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|