C28H40N6O4 — CID 178161539
4-[1-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]methyl]pyrazol-3-yl]piperidine-1-carbaldehyde;ethane;methoxyethane (PubChem CID 178161539) has the molecular formula C28H40N6O4 and a molecular weight of 524.67 g/mol. Its IUPAC name is 4-[1-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]methyl]pyrazol-3-yl]piperidine-1-carbaldehyde;ethane;methoxyethane.
| Compound Name | 4-[1-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]methyl]pyrazol-3-yl]piperidine-1-carbaldehyde;ethane;methoxyethane |
|---|---|
| PubChem CID | 178161539 |
| Molecular Formula | C28H40N6O4 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | 4-[1-[[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]methyl]pyrazol-3-yl]piperidine-1-carbaldehyde;ethane;methoxyethane |
| SMILES | CC.CCOC.Cn1nc(C2CCC(=O)NC2=O)c2ccc(Cn3ccc(C4CCN(C=O)CC4)n3)cc21 |
| InChI | InChI=1S/C23H26N6O3.C3H8O.C2H6/c1-27-20-12-15(2-3-17(20)22(26-27)18-4-5-21(31)24-23(18)32)13-29-11-8-19(25-29)16-6-9-28(14-30)10-7-16;1-3-4-2;1-2/h2-3,8,11-12,14,16,18H,4-7,9-10,13H2,1H3,(H,24,31,32);3H2,1-2H3;1-2H3 |
| InChIKey | ACCYLANDDPEPTQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|