C39H49N9O4 — CID 177362584
tert-butyl 2-[4-[4-[2-[4-(2,4-dioxo-1,3-diazinan-1-yl)-3-methylphenyl]-2,6-diazaspiro[3.3]heptan-6-yl]piperidin-1-yl]anilino]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate (PubChem CID 177362584) has the molecular formula C39H49N9O4 and a molecular weight of 707.88 g/mol. Its IUPAC name is tert-butyl 2-[4-[4-[2-[4-(2,4-dioxo-1,3-diazinan-1-yl)-3-methylphenyl]-2,6-diazaspiro[3.3]heptan-6-yl]piperidin-1-yl]anilino]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate.
| Compound Name | tert-butyl 2-[4-[4-[2-[4-(2,4-dioxo-1,3-diazinan-1-yl)-3-methylphenyl]-2,6-diazaspiro[3.3]heptan-6-yl]piperidin-1-yl]anilino]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 177362584 |
| Molecular Formula | C39H49N9O4 |
| Molecular Weight | 707.88 g/mol |
| Exact Mass | 707.39 |
| IUPAC Name | tert-butyl 2-[4-[4-[2-[4-(2,4-dioxo-1,3-diazinan-1-yl)-3-methylphenyl]-2,6-diazaspiro[3.3]heptan-6-yl]piperidin-1-yl]anilino]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
| SMILES | Cc1cc(N2CC3(C2)CN(C2CCN(c4ccc(Nc5ncc6c(n5)CN(C(=O)OC(C)(C)C)CC6)cc4)CC2)C3)ccc1N1CCC(=O)NC1=O |
| InChI | InChI=1S/C39H49N9O4/c1-26-19-31(9-10-33(26)48-18-14-34(49)43-36(48)50)47-24-39(25-47)22-46(23-39)30-12-16-44(17-13-30)29-7-5-28(6-8-29)41-35-40-20-27-11-15-45(21-32(27)42-35)37(51)52-38(2,3)4/h5-10,19-20,30H,11-18,21-25H2,1-4H3,(H,40,41,42)(H,43,49,50) |
| InChIKey | JKRHMZXNENYHEY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.88 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|