C15H16N4O2S — CID 170324271
N-(2,2-dioxo-1,3-dihydro-2-benzothiophen-5-yl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-amine (PubChem CID 170324271) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is N-(2,2-dioxo-1,3-dihydro-2-benzothiophen-5-yl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-amine.
| Compound Name | N-(2,2-dioxo-1,3-dihydro-2-benzothiophen-5-yl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 170324271 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-(2,2-dioxo-1,3-dihydro-2-benzothiophen-5-yl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-amine |
| SMILES | O=S1(=O)Cc2ccc(Nc3ncc4c(n3)CNCC4)cc2C1 |
| InChI | InChI=1S/C15H16N4O2S/c20-22(21)8-11-1-2-13(5-12(11)9-22)18-15-17-6-10-3-4-16-7-14(10)19-15/h1-2,5-6,16H,3-4,7-9H2,(H,17,18,19) |
| InChIKey | XHMPENLHPBQBAA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |