C16H17N7 — CID 170324062
N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-amine (PubChem CID 170324062) has the molecular formula C16H17N7 and a molecular weight of 307.36 g/mol. Its IUPAC name is N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-amine.
| Compound Name | N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 170324062 |
| Molecular Formula | C16H17N7 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-amine |
| SMILES | c1ncn(Cc2ccc(Nc3ncc4c(n3)CNCC4)cc2)n1 |
| InChI | InChI=1S/C16H17N7/c1-3-14(4-2-12(1)9-23-11-18-10-20-23)21-16-19-7-13-5-6-17-8-15(13)22-16/h1-4,7,10-11,17H,5-6,8-9H2,(H,19,21,22) |
| InChIKey | CIAYLUSTVUGOBJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |