C30H34N8O2 — CID 24998719
tert-butyl 7-methyl-4-[6-[4-(4-methylpiperazin-1-yl)anilino]pyrazolo[3,4-d]pyrimidin-1-yl]indole-1-carboxylate (PubChem CID 24998719) has the molecular formula C30H34N8O2 and a molecular weight of 538.66 g/mol. Its IUPAC name is tert-butyl 7-methyl-4-[6-[4-(4-methylpiperazin-1-yl)anilino]pyrazolo[3,4-d]pyrimidin-1-yl]indole-1-carboxylate.
| Compound Name | tert-butyl 7-methyl-4-[6-[4-(4-methylpiperazin-1-yl)anilino]pyrazolo[3,4-d]pyrimidin-1-yl]indole-1-carboxylate |
|---|---|
| PubChem CID | 24998719 |
| Molecular Formula | C30H34N8O2 |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | tert-butyl 7-methyl-4-[6-[4-(4-methylpiperazin-1-yl)anilino]pyrazolo[3,4-d]pyrimidin-1-yl]indole-1-carboxylate |
| SMILES | Cc1ccc(-n2ncc3cnc(Nc4ccc(N5CCN(C)CC5)cc4)nc32)c2ccn(C(=O)OC(C)(C)C)c12 |
| InChI | InChI=1S/C30H34N8O2/c1-20-6-11-25(24-12-13-37(26(20)24)29(39)40-30(2,3)4)38-27-21(19-32-38)18-31-28(34-27)33-22-7-9-23(10-8-22)36-16-14-35(5)15-17-36/h6-13,18-19H,14-17H2,1-5H3,(H,31,33,34) |
| InChIKey | LMQGGWATBUQBNT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|