C23H22N8O — CID 53385751
9-(1H-indazol-6-yl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]purine (PubChem CID 53385751) has the molecular formula C23H22N8O and a molecular weight of 426.48 g/mol. Its IUPAC name is 9-(1H-indazol-6-yl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]purine.
| Compound Name | 9-(1H-indazol-6-yl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]purine |
|---|---|
| PubChem CID | 53385751 |
| Molecular Formula | C23H22N8O |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 9-(1H-indazol-6-yl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]purine |
| SMILES | COc1ccccc1N1CCN(c2ncc3ncn(-c4ccc5cn[nH]c5c4)c3n2)CC1 |
| InChI | InChI=1S/C23H22N8O/c1-32-21-5-3-2-4-20(21)29-8-10-30(11-9-29)23-24-14-19-22(27-23)31(15-25-19)17-7-6-16-13-26-28-18(16)12-17/h2-7,12-15H,8-11H2,1H3,(H,26,28) |
| InChIKey | WZENRDFQQNESPZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |