C22H22N6 — CID 112881001
3-[[6-(4-methylpiperazin-1-yl)-2-phenylpyrimidin-4-yl]amino]benzonitrile (PubChem CID 112881001) has the molecular formula C22H22N6 and a molecular weight of 370.46 g/mol. Its IUPAC name is 3-[[6-(4-methylpiperazin-1-yl)-2-phenylpyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 3-[[6-(4-methylpiperazin-1-yl)-2-phenylpyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112881001 |
| Molecular Formula | C22H22N6 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 3-[[6-(4-methylpiperazin-1-yl)-2-phenylpyrimidin-4-yl]amino]benzonitrile |
| SMILES | CN1CCN(c2cc(Nc3cccc(C#N)c3)nc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C22H22N6/c1-27-10-12-28(13-11-27)21-15-20(24-19-9-5-6-17(14-19)16-23)25-22(26-21)18-7-3-2-4-8-18/h2-9,14-15H,10-13H2,1H3,(H,24,25,26) |
| InChIKey | OKLKXGGRABDZLM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 68.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |