C17H21N5O3 — CID 70019999
2-[2-(2-anilino-6-methoxypurin-9-yl)ethyl]propane-1,3-diol (PubChem CID 70019999) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 2-[2-(2-anilino-6-methoxypurin-9-yl)ethyl]propane-1,3-diol.
| Compound Name | 2-[2-(2-anilino-6-methoxypurin-9-yl)ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 70019999 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-[2-(2-anilino-6-methoxypurin-9-yl)ethyl]propane-1,3-diol |
| SMILES | COc1nc(Nc2ccccc2)nc2c1ncn2CCC(CO)CO |
| InChI | InChI=1S/C17H21N5O3/c1-25-16-14-15(22(11-18-14)8-7-12(9-23)10-24)20-17(21-16)19-13-5-3-2-4-6-13/h2-6,11-12,23-24H,7-10H2,1H3,(H,19,20,21) |
| InChIKey | JEBNETXQUIGDLI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |